C12H14BrN3O2S — CID 136572085
3-(6-bromo-5-methoxy-2-pyridinyl)-5-(1-methylsulfanylpropan-2-yl)-1,2,4-oxadiazole (PubChem CID 136572085) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is 3-(6-bromo-5-methoxy-2-pyridinyl)-5-(1-methylsulfanylpropan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(6-bromo-5-methoxy-2-pyridinyl)-5-(1-methylsulfanylpropan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 136572085 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 3-(6-bromo-5-methoxy-2-pyridinyl)-5-(1-methylsulfanylpropan-2-yl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc(C(C)CSC)n2)nc1Br |
| InChI | InChI=1S/C12H14BrN3O2S/c1-7(6-19-3)12-15-11(16-18-12)8-4-5-9(17-2)10(13)14-8/h4-5,7H,6H2,1-3H3 |
| InChIKey | KVMYCJGWFPCENX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|