About 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one
3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one (PubChem CID 136572621) has the molecular formula C15H24F2N2O3
and a molecular weight of 318.36 g/mol. Its IUPAC name is 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one |
| PubChem CID | 136572621 |
| Molecular Formula | C15H24F2N2O3 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(N1CCN(C2CCCC2O)CC1)C(F)(F)C(O)C1CC1 |
| InChI | InChI=1S/C15H24F2N2O3/c16-15(17,13(21)10-4-5-10)14(22)19-8-6-18(7-9-19)11-2-1-3-12(11)20/h10-13,20-21H,1-9H2 |
| InChIKey | JMKUJHYFQXGLGL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one?
The IUPAC name of 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one (CID 136572621) is 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one.
What is the SMILES notation for 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one?
The canonical SMILES for 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one is O=C(N1CCN(C2CCCC2O)CC1)C(F)(F)C(O)C1CC1.
What is the InChIKey of 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one?
The InChIKey is JMKUJHYFQXGLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2N2O3/c16-15(17,13(21)10-4-5-10)14(22)19-8-6-18(7-9-19)11-2-1-3-12(11)20/h10-13,20-21H,1-9H2.
What are the key properties of 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one?
3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one has a molecular weight of 318.36 g/mol, XLogP of 0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-2,2-difluoro-3-hydroxy-1-[4-(2-hydroxycyclopentyl)piperazin-1-yl]propan-1-one is sourced from PubChem (CID 136572621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).