C15H19NO3S — CID 136572672
[5-[3-(2-propoxyethoxy)phenyl]-1,3-thiazol-4-yl]methanol (PubChem CID 136572672) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is [5-[3-(2-propoxyethoxy)phenyl]-1,3-thiazol-4-yl]methanol.
| Compound Name | [5-[3-(2-propoxyethoxy)phenyl]-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 136572672 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | [5-[3-(2-propoxyethoxy)phenyl]-1,3-thiazol-4-yl]methanol |
| SMILES | CCCOCCOc1cccc(-c2scnc2CO)c1 |
| InChI | InChI=1S/C15H19NO3S/c1-2-6-18-7-8-19-13-5-3-4-12(9-13)15-14(10-17)16-11-20-15/h3-5,9,11,17H,2,6-8,10H2,1H3 |
| InChIKey | NOKWGDIOWQESQK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|