About 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine
2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine (PubChem CID 136572944) has the molecular formula C16H24N6O
and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine.
Molecular Properties
| Compound Name | 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine |
| PubChem CID | 136572944 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine |
| SMILES | CCn1c(-c2cnccn2)nnc1N1CCC(C)(COC)CC1 |
| InChI | InChI=1S/C16H24N6O/c1-4-22-14(13-11-17-7-8-18-13)19-20-15(22)21-9-5-16(2,6-10-21)12-23-3/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | WYLGVQVDEKVJFC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine?
The IUPAC name of 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine (CID 136572944) is 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine.
What is the SMILES notation for 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine?
The canonical SMILES for 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine is CCn1c(-c2cnccn2)nnc1N1CCC(C)(COC)CC1.
What is the InChIKey of 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine?
The InChIKey is WYLGVQVDEKVJFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N6O/c1-4-22-14(13-11-17-7-8-18-13)19-20-15(22)21-9-5-16(2,6-10-21)12-23-3/h7-8,11H,4-6,9-10,12H2,1-3H3.
What are the key properties of 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine?
2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine has a molecular weight of 316.41 g/mol, XLogP of 2.01, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-ethyl-5-[4-(methoxymethyl)-4-methylpiperidin-1-yl]-1,2,4-triazol-3-yl]pyrazine is sourced from PubChem (CID 136572944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).