About N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride
N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride (PubChem CID 136574201) has the molecular formula C10H22Cl2N2O
and a molecular weight of 257.20 g/mol. Its IUPAC name is N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride |
| PubChem CID | 136574201 |
| Molecular Formula | C10H22Cl2N2O |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride |
| SMILES | CN(C)C1CNCC12CCOCC2.Cl.Cl |
| InChI | InChI=1S/C10H20N2O.2ClH/c1-12(2)9-7-11-8-10(9)3-5-13-6-4-10;;/h9,11H,3-8H2,1-2H3;2*1H |
| InChIKey | SGUYAVLQAUTQNL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride?
The IUPAC name of N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride (CID 136574201) is N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride.
What is the SMILES notation for N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride?
The canonical SMILES for N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride is CN(C)C1CNCC12CCOCC2.Cl.Cl.
What is the InChIKey of N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride?
The InChIKey is SGUYAVLQAUTQNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.2ClH/c1-12(2)9-7-11-8-10(9)3-5-13-6-4-10;;/h9,11H,3-8H2,1-2H3;2*1H.
What are the key properties of N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride?
N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride has a molecular weight of 257.20 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-8-oxa-2-azaspiro[4.5]decan-4-amine;dihydrochloride is sourced from PubChem (CID 136574201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).