C12H22O3 — CID 136574824
2-(3-(Tert-butoxy)-2,2-dimethylcyclobutyl)acetic acid (PubChem CID 136574824) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]cyclobutyl]acetic acid.
| Compound Name | 2-(3-(Tert-butoxy)-2,2-dimethylcyclobutyl)acetic acid |
|---|---|
| PubChem CID | 136574824 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]cyclobutyl]acetic acid |
| SMILES | CC1(C(CC1OC(C)(C)C)CC(=O)O)C |
| InChI | InChI=1S/C12H22O3/c1-11(2,3)15-9-6-8(7-10(13)14)12(9,4)5/h8-9H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | WEBFZAVQBZMIDG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 250 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |