About 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride
3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 136574826) has the molecular formula C5H8ClN3O
and a molecular weight of 161.59 g/mol. Its IUPAC name is 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride.
Molecular Properties
| Compound Name | 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride |
| PubChem CID | 136574826 |
| Molecular Formula | C5H8ClN3O |
| Molecular Weight | 161.59 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cl.c1nc(C2CCN2)no1 |
| InChI | InChI=1S/C5H7N3O.ClH/c1-2-6-4(1)5-7-3-9-8-5;/h3-4,6H,1-2H2;1H |
| InChIKey | XKQUNKPBKOFTQG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.59 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride?
The IUPAC name of 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride (CID 136574826) is 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride.
What is the SMILES notation for 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride?
The canonical SMILES for 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride is Cl.c1nc(C2CCN2)no1.
What is the InChIKey of 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride?
The InChIKey is XKQUNKPBKOFTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O.ClH/c1-2-6-4(1)5-7-3-9-8-5;/h3-4,6H,1-2H2;1H.
What are the key properties of 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride?
3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride has a molecular weight of 161.59 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azetidin-2-yl)-1,2,4-oxadiazole;hydrochloride is sourced from PubChem (CID 136574826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).