C16H23N3O3S — CID 136575021
4-cyano-N-cyclopentyl-2-(3-methoxypropylamino)benzenesulfonamide (PubChem CID 136575021) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-cyano-N-cyclopentyl-2-(3-methoxypropylamino)benzenesulfonamide.
| Compound Name | 4-cyano-N-cyclopentyl-2-(3-methoxypropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 136575021 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4-cyano-N-cyclopentyl-2-(3-methoxypropylamino)benzenesulfonamide |
| SMILES | COCCCNc1cc(C#N)ccc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H23N3O3S/c1-22-10-4-9-18-15-11-13(12-17)7-8-16(15)23(20,21)19-14-5-2-3-6-14/h7-8,11,14,18-19H,2-6,9-10H2,1H3 |
| InChIKey | CXELJEVZNUAJKQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|