C19H18N6O2 — CID 136576879
2-(5-methoxy-1H-indol-3-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]acetamide (PubChem CID 136576879) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]acetamide.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 136576879 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]acetamide |
| SMILES | COc1ccc2[nH]cc(CC(=O)Nc3cccc(-c4nnnn4C)c3)c2c1 |
| InChI | InChI=1S/C19H18N6O2/c1-25-19(22-23-24-25)12-4-3-5-14(8-12)21-18(26)9-13-11-20-17-7-6-15(27-2)10-16(13)17/h3-8,10-11,20H,9H2,1-2H3,(H,21,26) |
| InChIKey | QEXYARKLBDUMOG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |