About 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one
5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one (PubChem CID 136577342) has the molecular formula C16H11FN4OS
and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one |
| PubChem CID | 136577342 |
| Molecular Formula | C16H11FN4OS |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one |
| SMILES | Cn1c(=NN=C2C(=O)Nc3ccc(F)cc32)sc2ccccc21 |
| InChI | InChI=1S/C16H11FN4OS/c1-21-12-4-2-3-5-13(12)23-16(21)20-19-14-10-8-9(17)6-7-11(10)18-15(14)22/h2-8H,1H3,(H,18,19,22) |
| InChIKey | GIWRFYWNACZRKG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one?
The IUPAC name of 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one (CID 136577342) is 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one.
What is the SMILES notation for 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one?
The canonical SMILES for 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one is Cn1c(=NN=C2C(=O)Nc3ccc(F)cc32)sc2ccccc21.
What is the InChIKey of 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one?
The InChIKey is GIWRFYWNACZRKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11FN4OS/c1-21-12-4-2-3-5-13(12)23-16(21)20-19-14-10-8-9(17)6-7-11(10)18-15(14)22/h2-8H,1H3,(H,18,19,22).
What are the key properties of 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one?
5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one has a molecular weight of 326.36 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1H-indol-2-one is sourced from PubChem (CID 136577342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).