C12H6F3N7S — CID 136577628
7-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136577628) has the molecular formula C12H6F3N7S and a molecular weight of 337.29 g/mol. Its IUPAC name is 7-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136577628 |
| Molecular Formula | C12H6F3N7S |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 7-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | FC(F)(F)c1cc(Sc2nnc3ccccn23)n2ncnc2n1 |
| InChI | InChI=1S/C12H6F3N7S/c13-12(14,15)7-5-9(22-10(18-7)16-6-17-22)23-11-20-19-8-3-1-2-4-21(8)11/h1-6H |
| InChIKey | VFZCMPXZGHWHFN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |