About 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine
6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine (PubChem CID 136577684) has the molecular formula C15H14F2N6O
and a molecular weight of 332.31 g/mol. Its IUPAC name is 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine |
| PubChem CID | 136577684 |
| Molecular Formula | C15H14F2N6O |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine |
| SMILES | Fc1ccc(OC2CCN(c3ccc4nnnn4n3)CC2)c(F)c1 |
| InChI | InChI=1S/C15H14F2N6O/c16-10-1-2-13(12(17)9-10)24-11-5-7-22(8-6-11)15-4-3-14-18-20-21-23(14)19-15/h1-4,9,11H,5-8H2 |
| InChIKey | BDXJTYHVASMFEF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine?
The IUPAC name of 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine (CID 136577684) is 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine.
What is the SMILES notation for 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine?
The canonical SMILES for 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine is Fc1ccc(OC2CCN(c3ccc4nnnn4n3)CC2)c(F)c1.
What is the InChIKey of 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine?
The InChIKey is BDXJTYHVASMFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N6O/c16-10-1-2-13(12(17)9-10)24-11-5-7-22(8-6-11)15-4-3-14-18-20-21-23(14)19-15/h1-4,9,11H,5-8H2.
What are the key properties of 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine?
6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine has a molecular weight of 332.31 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,4-difluorophenoxy)piperidin-1-yl]tetrazolo[1,5-b]pyridazine is sourced from PubChem (CID 136577684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).