C17H25N5O4 — CID 136578251
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide (PubChem CID 136578251) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 136578251 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2cnn(CC3CCCO3)c2)C1=O |
| InChI | InChI=1S/C17H25N5O4/c1-3-17(4-2)15(24)22(16(25)20-17)11-14(23)19-12-8-18-21(9-12)10-13-6-5-7-26-13/h8-9,13H,3-7,10-11H2,1-2H3,(H,19,23)(H,20,25) |
| InChIKey | RCPAVFBONPAAMU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|