About (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride (PubChem CID 136579353) has the molecular formula C11H15ClN4O2S2
and a molecular weight of 334.85 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride |
| PubChem CID | 136579353 |
| Molecular Formula | C11H15ClN4O2S2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride |
| SMILES | COCC/N=C(\N)SCc1nc2ccsc2c(=O)[nH]1.Cl |
| InChI | InChI=1S/C11H14N4O2S2.ClH/c1-17-4-3-13-11(12)19-6-8-14-7-2-5-18-9(7)10(16)15-8;/h2,5H,3-4,6H2,1H3,(H2,12,13)(H,14,15,16);1H |
| InChIKey | HOLOWXHQUFCCOP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride?
The IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride (CID 136579353) is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride.
What is the SMILES notation for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride?
The canonical SMILES for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride is COCC/N=C(\N)SCc1nc2ccsc2c(=O)[nH]1.Cl.
What is the InChIKey of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride?
The InChIKey is HOLOWXHQUFCCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S2.ClH/c1-17-4-3-13-11(12)19-6-8-14-7-2-5-18-9(7)10(16)15-8;/h2,5H,3-4,6H2,1H3,(H2,12,13)(H,14,15,16);1H.
What are the key properties of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride?
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride has a molecular weight of 334.85 g/mol, XLogP of 1.60, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate;hydrochloride is sourced from PubChem (CID 136579353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).