C20H28N6O2 — CID 136580013
1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea (PubChem CID 136580013) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea.
| Compound Name | 1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 136580013 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
| SMILES | CC(C)CC(=O)N1CCC(NC(=O)NCc2ccc(-n3ccnc3)nc2)CC1 |
| InChI | InChI=1S/C20H28N6O2/c1-15(2)11-19(27)25-8-5-17(6-9-25)24-20(28)23-13-16-3-4-18(22-12-16)26-10-7-21-14-26/h3-4,7,10,12,14-15,17H,5-6,8-9,11,13H2,1-2H3,(H2,23,24,28) |
| InChIKey | QKMWMZBACVNGDD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |