About [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol
[(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol (PubChem CID 136581039) has the molecular formula C10H21NO4S
and a molecular weight of 251.35 g/mol. Its IUPAC name is [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol |
| PubChem CID | 136581039 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol |
| SMILES | COCCCS(=O)(=O)N1C[C@@H](CO)[C@H](C)C1 |
| InChI | InChI=1S/C10H21NO4S/c1-9-6-11(7-10(9)8-12)16(13,14)5-3-4-15-2/h9-10,12H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | IQIVYNNQHSVHMF-ZJUUUORDSA-N |
| XLogP | -0.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol (CID 136581039) is [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol is COCCCS(=O)(=O)N1C[C@@H](CO)[C@H](C)C1.
What is the InChIKey of [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol?
The InChIKey is IQIVYNNQHSVHMF-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H21NO4S/c1-9-6-11(7-10(9)8-12)16(13,14)5-3-4-15-2/h9-10,12H,3-8H2,1-2H3/t9-,10+/m1/s1.
What are the key properties of [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol?
[(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol has a molecular weight of 251.35 g/mol, XLogP of -0.09, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-1-(3-methoxypropylsulfonyl)-4-methylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 136581039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).