About N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide
N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide (PubChem CID 136581114) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide |
| PubChem CID | 136581114 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide |
| SMILES | O=C(NCC1CC1)C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H20N2O3/c15-10-4-2-1-3-9(10)14-12(17)11(16)13-7-8-5-6-8/h8-10,15H,1-7H2,(H,13,16)(H,14,17)/t9-,10-/m0/s1 |
| InChIKey | COZLZNWLGJTNOS-UWVGGRQHSA-N |
| XLogP | -0.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide?
The IUPAC name of N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide (CID 136581114) is N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide.
What is the SMILES notation for N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide?
The canonical SMILES for N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide is O=C(NCC1CC1)C(=O)N[C@H]1CCCC[C@@H]1O.
What is the InChIKey of N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide?
The InChIKey is COZLZNWLGJTNOS-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H20N2O3/c15-10-4-2-1-3-9(10)14-12(17)11(16)13-7-8-5-6-8/h8-10,15H,1-7H2,(H,13,16)(H,14,17)/t9-,10-/m0/s1.
What are the key properties of N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide?
N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide has a molecular weight of 240.30 g/mol, XLogP of -0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-N'-[(1S,2S)-2-hydroxycyclohexyl]oxamide is sourced from PubChem (CID 136581114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).