C17H22N2O2 — CID 136581170
N-[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]quinoline-8-carboxamide (PubChem CID 136581170) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]quinoline-8-carboxamide.
| Compound Name | N-[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 136581170 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]quinoline-8-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccc2cccnc12)C(C)(C)O |
| InChI | InChI=1S/C17H22N2O2/c1-11(2)15(17(3,4)21)19-16(20)13-9-5-7-12-8-6-10-18-14(12)13/h5-11,15,21H,1-4H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | WKDMHRKBCGAMJO-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |