C16H22N6O4 — CID 136581301
2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]pyrrolidine-1-carboxamide (PubChem CID 136581301) has the molecular formula C16H22N6O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 136581301 |
| Molecular Formula | C16H22N6O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]pyrrolidine-1-carboxamide |
| SMILES | Cc1noc([C@@H]2CC[C@H](CNC(=O)N3CCCC3c3noc(C)n3)O2)n1 |
| InChI | InChI=1S/C16H22N6O4/c1-9-18-15(26-20-9)13-6-5-11(24-13)8-17-16(23)22-7-3-4-12(22)14-19-10(2)25-21-14/h11-13H,3-8H2,1-2H3,(H,17,23)/t11-,12?,13+/m1/s1 |
| InChIKey | RTRVUDHNPTYKEJ-YPHAAILGSA-N |
| XLogP | 1.84 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |