C20H28N2O — CID 136581394
1-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone (PubChem CID 136581394) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone.
| Compound Name | 1-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 136581394 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[(3aR,6aS)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)N1C[C@H]2CN(Cc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C20H28N2O/c23-20(10-16-6-4-5-7-16)22-14-18-12-21(13-19(18)15-22)11-17-8-2-1-3-9-17/h1-3,8-9,16,18-19H,4-7,10-15H2/t18-,19+ |
| InChIKey | HRNGPHVBQLNPJX-KDURUIRLSA-N |
| XLogP | 3.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |