About N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide
N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide (PubChem CID 136581602) has the molecular formula C8H15NO3S
and a molecular weight of 205.28 g/mol. Its IUPAC name is N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide |
| PubChem CID | 136581602 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide |
| SMILES | CC[C@@H]1C[C@H]1NC(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C8H15NO3S/c1-3-6-4-7(6)9-8(10)5-13(2,11)12/h6-7H,3-5H2,1-2H3,(H,9,10)/t6-,7-/m1/s1 |
| InChIKey | RXTOJCHKUAGZCQ-RNFRBKRXSA-N |
| XLogP | -0.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide?
The IUPAC name of N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide (CID 136581602) is N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide.
What is the SMILES notation for N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide?
The canonical SMILES for N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide is CC[C@@H]1C[C@H]1NC(=O)CS(C)(=O)=O.
What is the InChIKey of N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide?
The InChIKey is RXTOJCHKUAGZCQ-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H15NO3S/c1-3-6-4-7(6)9-8(10)5-13(2,11)12/h6-7H,3-5H2,1-2H3,(H,9,10)/t6-,7-/m1/s1.
What are the key properties of N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide?
N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide has a molecular weight of 205.28 g/mol, XLogP of -0.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-ethylcyclopropyl]-2-methylsulfonylacetamide is sourced from PubChem (CID 136581602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).