C19H28N2O5S — CID 136581701
2-ethyl-5-[(3R)-3-(morpholin-4-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 136581701) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-ethyl-5-[(3R)-3-(morpholin-4-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-ethyl-5-[(3R)-3-(morpholin-4-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 136581701 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-ethyl-5-[(3R)-3-(morpholin-4-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC[C@H](CN3CCOCC3)C2)cc1C(=O)O |
| InChI | InChI=1S/C19H28N2O5S/c1-2-16-5-6-17(12-18(16)19(22)23)27(24,25)21-7-3-4-15(14-21)13-20-8-10-26-11-9-20/h5-6,12,15H,2-4,7-11,13-14H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | FZKZTZQHKVCYLM-OAHLLOKOSA-N |
| XLogP | 1.68 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |