C13H20N4O2 — CID 136581874
(3aR,7aS)-1-methyl-5-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 136581874) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is (3aR,7aS)-1-methyl-5-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | (3aR,7aS)-1-methyl-5-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 136581874 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (3aR,7aS)-1-methyl-5-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | Cc1cnc(C(C)N2CC[C@H]3[C@@H](C2)NC(=O)N3C)o1 |
| InChI | InChI=1S/C13H20N4O2/c1-8-6-14-12(19-8)9(2)17-5-4-11-10(7-17)15-13(18)16(11)3/h6,9-11H,4-5,7H2,1-3H3,(H,15,18)/t9?,10-,11+/m1/s1 |
| InChIKey | ROYHCXBXMIPXGJ-ZOCYIJKUSA-N |
| XLogP | 1.14 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |