C16H21N3O — CID 136582264
N-(4-ethylcyclohexyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 136582264) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(4-ethylcyclohexyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136582264 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-(4-ethylcyclohexyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCC1CCC(NC(=O)c2cnc3ccccn23)CC1 |
| InChI | InChI=1S/C16H21N3O/c1-2-12-6-8-13(9-7-12)18-16(20)14-11-17-15-5-3-4-10-19(14)15/h3-5,10-13H,2,6-9H2,1H3,(H,18,20) |
| InChIKey | OBQVSWOGXMJJIY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |