C17H26ClN3O3S — CID 136582326
4-[3-chloro-2-[[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]methyl]phenyl]morpholine (PubChem CID 136582326) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is 4-[3-chloro-2-[[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]methyl]phenyl]morpholine.
| Compound Name | 4-[3-chloro-2-[[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 136582326 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[3-chloro-2-[[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]methyl]phenyl]morpholine |
| SMILES | C[C@H]1CN(Cc2c(Cl)cccc2N2CCOCC2)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C17H26ClN3O3S/c1-14-12-19(6-7-21(14)25(2,22)23)13-15-16(18)4-3-5-17(15)20-8-10-24-11-9-20/h3-5,14H,6-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | IMLFVZSJPVTGGA-AWEZNQCLSA-N |
| XLogP | 1.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |