C9H14Cl2N2O — CID 136582717
(2S,3R)-2-pyridin-3-yloxolan-3-amine;dihydrochloride (PubChem CID 136582717) has the molecular formula C9H14Cl2N2O and a molecular weight of 237.13 g/mol. Its IUPAC name is (2S,3R)-2-pyridin-3-yloxolan-3-amine;dihydrochloride.
| Compound Name | (2S,3R)-2-pyridin-3-yloxolan-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 136582717 |
| Molecular Formula | C9H14Cl2N2O |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (2S,3R)-2-pyridin-3-yloxolan-3-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1CCO[C@H]1c1cccnc1 |
| InChI | InChI=1S/C9H12N2O.2ClH/c10-8-3-5-12-9(8)7-2-1-4-11-6-7;;/h1-2,4,6,8-9H,3,5,10H2;2*1H/t8-,9+;;/m1../s1 |
| InChIKey | ALFBARQSSVNDBG-BPRGXCPLSA-N |
| XLogP | 1.71 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |