C17H24N2O4S — CID 136583192
cis-(1R,2S)-1-N,1-N-dimethyl-2-N-(2,3,5,6-tetramethylphenyl)sulfonylcyclopropane-1,2-dicarboxamide (PubChem CID 136583192) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is cis-(1R,2S)-1-N,1-N-dimethyl-2-N-(2,3,5,6-tetramethylphenyl)sulfonylcyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-1-N,1-N-dimethyl-2-N-(2,3,5,6-tetramethylphenyl)sulfonylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 136583192 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | cis-(1R,2S)-1-N,1-N-dimethyl-2-N-(2,3,5,6-tetramethylphenyl)sulfonylcyclopropane-1,2-dicarboxamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC(=O)[C@H]2C[C@H]2C(=O)N(C)C)c1C |
| InChI | InChI=1S/C17H24N2O4S/c1-9-7-10(2)12(4)15(11(9)3)24(22,23)18-16(20)13-8-14(13)17(21)19(5)6/h7,13-14H,8H2,1-6H3,(H,18,20)/t13-,14+/m0/s1 |
| InChIKey | PDAQMNJJNGZUID-UONOGXRCSA-N |
| XLogP | 1.45 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |