C16H15N3O4 — CID 136583522
(2R,3S)-3-[(2-phenylpyrimidine-5-carbonyl)amino]oxolane-2-carboxylic acid (PubChem CID 136583522) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is (2R,3S)-3-[(2-phenylpyrimidine-5-carbonyl)amino]oxolane-2-carboxylic acid.
| Compound Name | (2R,3S)-3-[(2-phenylpyrimidine-5-carbonyl)amino]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 136583522 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2R,3S)-3-[(2-phenylpyrimidine-5-carbonyl)amino]oxolane-2-carboxylic acid |
| SMILES | O=C(N[C@H]1CCO[C@H]1C(=O)O)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C16H15N3O4/c20-15(19-12-6-7-23-13(12)16(21)22)11-8-17-14(18-9-11)10-4-2-1-3-5-10/h1-5,8-9,12-13H,6-7H2,(H,19,20)(H,21,22)/t12-,13+/m0/s1 |
| InChIKey | NAYGQMZPOGBFOF-QWHCGFSZSA-N |
| XLogP | 1.12 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |