C18H22N4O2 — CID 136584840
1-[(2S,3R)-2-phenyloxolan-3-yl]-3-(4,5,6,7-tetrahydro-1H-indazol-6-yl)urea (PubChem CID 136584840) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(2S,3R)-2-phenyloxolan-3-yl]-3-(4,5,6,7-tetrahydro-1H-indazol-6-yl)urea.
| Compound Name | 1-[(2S,3R)-2-phenyloxolan-3-yl]-3-(4,5,6,7-tetrahydro-1H-indazol-6-yl)urea |
|---|---|
| PubChem CID | 136584840 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(2S,3R)-2-phenyloxolan-3-yl]-3-(4,5,6,7-tetrahydro-1H-indazol-6-yl)urea |
| SMILES | O=C(NC1CCc2cn[nH]c2C1)N[C@@H]1CCO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H22N4O2/c23-18(20-14-7-6-13-11-19-22-16(13)10-14)21-15-8-9-24-17(15)12-4-2-1-3-5-12/h1-5,11,14-15,17H,6-10H2,(H,19,22)(H2,20,21,23)/t14?,15-,17+/m1/s1 |
| InChIKey | YWTOOSZBGGDROW-LBVBGPOBSA-N |
| XLogP | 2.10 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |