C18H28N2O4 — CID 136584911
tert-butyl N-[(1S)-1-[2-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]ethyl]carbamate (PubChem CID 136584911) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[2-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[2-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 136584911 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl N-[(1S)-1-[2-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]ethyl]carbamate |
| SMILES | CC(C)NC(=O)COc1ccccc1[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O4/c1-12(2)19-16(21)11-23-15-10-8-7-9-14(15)13(3)20-17(22)24-18(4,5)6/h7-10,12-13H,11H2,1-6H3,(H,19,21)(H,20,22)/t13-/m0/s1 |
| InChIKey | ANKJHSSVXBZAOP-ZDUSSCGKSA-N |
| XLogP | 3.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |