About 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea
1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea (PubChem CID 136585215) has the molecular formula C16H31N3O2
and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea.
Molecular Properties
| Compound Name | 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea |
| PubChem CID | 136585215 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea |
| SMILES | CCCCNC(=O)NC[C@@H]1CCCC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C16H31N3O2/c1-2-3-8-17-16(20)18-13-14-6-4-5-7-15(14)19-9-11-21-12-10-19/h14-15H,2-13H2,1H3,(H2,17,18,20)/t14-,15-/m0/s1 |
| InChIKey | YHLSHYIQWGGOBA-GJZGRUSLSA-N |
| XLogP | 1.98 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea?
The IUPAC name of 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea (CID 136585215) is 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea.
What is the SMILES notation for 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea?
The canonical SMILES for 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea is CCCCNC(=O)NC[C@@H]1CCCC[C@@H]1N1CCOCC1.
What is the InChIKey of 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea?
The InChIKey is YHLSHYIQWGGOBA-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H31N3O2/c1-2-3-8-17-16(20)18-13-14-6-4-5-7-15(14)19-9-11-21-12-10-19/h14-15H,2-13H2,1H3,(H2,17,18,20)/t14-,15-/m0/s1.
What are the key properties of 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea?
1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea has a molecular weight of 297.44 g/mol, XLogP of 1.98, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[[(1S,2S)-2-morpholin-4-ylcyclohexyl]methyl]urea is sourced from PubChem (CID 136585215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).