C16H24F2N4O2 — CID 136585385
(5S,7S)-7-(difluoromethyl)-N-(4-methoxycyclohexyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136585385) has the molecular formula C16H24F2N4O2 and a molecular weight of 342.39 g/mol. Its IUPAC name is (5S,7S)-7-(difluoromethyl)-N-(4-methoxycyclohexyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-7-(difluoromethyl)-N-(4-methoxycyclohexyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136585385 |
| Molecular Formula | C16H24F2N4O2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (5S,7S)-7-(difluoromethyl)-N-(4-methoxycyclohexyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COC1CCC(NC(=O)c2cnn3c2N[C@@H](C)C[C@H]3C(F)F)CC1 |
| InChI | InChI=1S/C16H24F2N4O2/c1-9-7-13(14(17)18)22-15(20-9)12(8-19-22)16(23)21-10-3-5-11(24-2)6-4-10/h8-11,13-14,20H,3-7H2,1-2H3,(H,21,23)/t9-,10?,11?,13-/m0/s1 |
| InChIKey | STYQAIKKBKFXCH-YUVKLTJASA-N |
| XLogP | 2.58 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |