C13H20N4O3S2 — CID 136585502
(3aS,6aR)-N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide (PubChem CID 136585502) has the molecular formula C13H20N4O3S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (3aS,6aR)-N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136585502 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (3aS,6aR)-N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
| SMILES | CC(C)(C)c1nsc(NC(=O)N2C[C@@H]3CS(=O)(=O)C[C@@H]3C2)n1 |
| InChI | InChI=1S/C13H20N4O3S2/c1-13(2,3)10-14-11(21-16-10)15-12(18)17-4-8-6-22(19,20)7-9(8)5-17/h8-9H,4-7H2,1-3H3,(H,14,15,16,18)/t8-,9+ |
| InChIKey | KCZOFIKVHXOCAH-DTORHVGOSA-N |
| XLogP | 1.34 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |