C18H22N4O2 — CID 136585512
1-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-3-(1-methylindol-6-yl)urea (PubChem CID 136585512) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-3-(1-methylindol-6-yl)urea.
| Compound Name | 1-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-3-(1-methylindol-6-yl)urea |
|---|---|
| PubChem CID | 136585512 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-3-(1-methylindol-6-yl)urea |
| SMILES | Cn1ccc2ccc(NC(=O)N[C@@]34CCCC[C@@H]3NC(=O)C4)cc21 |
| InChI | InChI=1S/C18H22N4O2/c1-22-9-7-12-5-6-13(10-14(12)22)19-17(24)21-18-8-3-2-4-15(18)20-16(23)11-18/h5-7,9-10,15H,2-4,8,11H2,1H3,(H,20,23)(H2,19,21,24)/t15-,18+/m0/s1 |
| InChIKey | ZWLQNICANYZNNN-MAUKXSAKSA-N |
| XLogP | 2.50 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |