C13H23N3O3S — CID 136585550
(4aR,7aS)-6-methyl-1-[(1-methylsulfonylazetidin-3-yl)methyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 136585550) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is (4aR,7aS)-6-methyl-1-[(1-methylsulfonylazetidin-3-yl)methyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-6-methyl-1-[(1-methylsulfonylazetidin-3-yl)methyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 136585550 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (4aR,7aS)-6-methyl-1-[(1-methylsulfonylazetidin-3-yl)methyl]-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | CN1C[C@@H]2[C@@H](CCCN2CC2CN(S(C)(=O)=O)C2)C1=O |
| InChI | InChI=1S/C13H23N3O3S/c1-14-9-12-11(13(14)17)4-3-5-15(12)6-10-7-16(8-10)20(2,18)19/h10-12H,3-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | GJNQJCSRQROZJM-VXGBXAGGSA-N |
| XLogP | -0.57 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |