C13H21N5O — CID 136585554
(3aR,7aS)-5-[(1,4-dimethylpyrazol-3-yl)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 136585554) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is (3aR,7aS)-5-[(1,4-dimethylpyrazol-3-yl)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | (3aR,7aS)-5-[(1,4-dimethylpyrazol-3-yl)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 136585554 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3aR,7aS)-5-[(1,4-dimethylpyrazol-3-yl)methyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | Cc1cn(C)nc1CN1CC[C@H]2[C@@H](C1)NC(=O)N2C |
| InChI | InChI=1S/C13H21N5O/c1-9-6-16(2)15-10(9)7-18-5-4-12-11(8-18)14-13(19)17(12)3/h6,11-12H,4-5,7-8H2,1-3H3,(H,14,19)/t11-,12+/m1/s1 |
| InChIKey | XZXPPFUGNZOHQU-NEPJUHHUSA-N |
| XLogP | 0.33 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |