C15H20N4O3S — CID 136585698
(3aR,6aS)-N-[2-(cyclopropylmethyl)pyrimidin-5-yl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide (PubChem CID 136585698) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is (3aR,6aS)-N-[2-(cyclopropylmethyl)pyrimidin-5-yl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-[2-(cyclopropylmethyl)pyrimidin-5-yl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136585698 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3aR,6aS)-N-[2-(cyclopropylmethyl)pyrimidin-5-yl]-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1cnc(CC2CC2)nc1)N1C[C@@H]2CS(=O)(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C15H20N4O3S/c20-15(19-6-11-8-23(21,22)9-12(11)7-19)18-13-4-16-14(17-5-13)3-10-1-2-10/h4-5,10-12H,1-3,6-9H2,(H,18,20)/t11-,12+ |
| InChIKey | ITRVYOIIBRJPGK-TXEJJXNPSA-N |
| XLogP | 0.94 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |