C18H24FN3O2 — CID 136586026
(3aR,6aR)-2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide (PubChem CID 136586026) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is (3aR,6aR)-2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 136586026 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (3aR,6aR)-2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
| SMILES | NC(=O)[C@]12CCC[C@H]1CN(CC(=O)NCCc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C18H24FN3O2/c19-15-5-3-13(4-6-15)7-9-21-16(23)11-22-10-14-2-1-8-18(14,12-22)17(20)24/h3-6,14H,1-2,7-12H2,(H2,20,24)(H,21,23)/t14-,18-/m0/s1 |
| InChIKey | KZOGSKNYEGORER-KSSFIOAISA-N |
| XLogP | 1.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |