C15H21N3O2 — CID 136586640
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methoxypyrimidin-4-yl)methanone (PubChem CID 136586640) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methoxypyrimidin-4-yl)methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methoxypyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 136586640 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methoxypyrimidin-4-yl)methanone |
| SMILES | COc1nccc(C(=O)N2CCC[C@@H]3CCCC[C@@H]32)n1 |
| InChI | InChI=1S/C15H21N3O2/c1-20-15-16-9-8-12(17-15)14(19)18-10-4-6-11-5-2-3-7-13(11)18/h8-9,11,13H,2-7,10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | VADPJQHCLJCHFZ-AAEUAGOBSA-N |
| XLogP | 2.28 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |