C13H15BrF2N2O2 — CID 136586692
3-bromo-2,5-difluoro-N-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethyl]benzamide (PubChem CID 136586692) has the molecular formula C13H15BrF2N2O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 3-bromo-2,5-difluoro-N-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethyl]benzamide.
| Compound Name | 3-bromo-2,5-difluoro-N-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 136586692 |
| Molecular Formula | C13H15BrF2N2O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-bromo-2,5-difluoro-N-[2-[(3R)-3-hydroxypyrrolidin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1CC[C@@H](O)C1)c1cc(F)cc(Br)c1F |
| InChI | InChI=1S/C13H15BrF2N2O2/c14-11-6-8(15)5-10(12(11)16)13(20)17-2-4-18-3-1-9(19)7-18/h5-6,9,19H,1-4,7H2,(H,17,20)/t9-/m1/s1 |
| InChIKey | SJNFXCQBOXUMKY-SECBINFHSA-N |
| XLogP | 1.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|