C16H24N4OS — CID 136587876
N-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide (PubChem CID 136587876) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is N-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide.
| Compound Name | N-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 136587876 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(2S)-1-(dimethylamino)-4-methylpentan-2-yl]-5-(1H-pyrazol-5-yl)thiophene-2-carboxamide |
| SMILES | CC(C)C[C@@H](CN(C)C)NC(=O)c1ccc(-c2ccn[nH]2)s1 |
| InChI | InChI=1S/C16H24N4OS/c1-11(2)9-12(10-20(3)4)18-16(21)15-6-5-14(22-15)13-7-8-17-19-13/h5-8,11-12H,9-10H2,1-4H3,(H,17,19)(H,18,21)/t12-/m0/s1 |
| InChIKey | MQCBTCWPPOIGSM-LBPRGKRZSA-N |
| XLogP | 2.84 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |