C13H15F3N2O3S — CID 136587949
[(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 136587949) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrrol-3-yl)methanone.
| Compound Name | [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 136587949 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(4aS,7aS)-1,1-dioxo-4a-(trifluoromethyl)-2,3,4,5,7,7a-hexahydrothiopyrano[2,3-c]pyrrol-6-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | O=C(c1cc[nH]c1)N1C[C@@H]2[C@@](C(F)(F)F)(CCCS2(=O)=O)C1 |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)12-3-1-5-22(20,21)10(12)7-18(8-12)11(19)9-2-4-17-6-9/h2,4,6,10,17H,1,3,5,7-8H2/t10-,12-/m1/s1 |
| InChIKey | BHARHLCAHXYFBC-ZYHUDNBSSA-N |
| XLogP | 1.60 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |