C17H27F2N3O2 — CID 136587960
N-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-2-[1-(2,2-difluoroethyl)piperidin-4-yl]acetamide (PubChem CID 136587960) has the molecular formula C17H27F2N3O2 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-2-[1-(2,2-difluoroethyl)piperidin-4-yl]acetamide.
| Compound Name | N-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-2-[1-(2,2-difluoroethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 136587960 |
| Molecular Formula | C17H27F2N3O2 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | N-[(3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indol-3a-yl]-2-[1-(2,2-difluoroethyl)piperidin-4-yl]acetamide |
| SMILES | O=C1C[C@]2(NC(=O)CC3CCN(CC(F)F)CC3)CCCC[C@@H]2N1 |
| InChI | InChI=1S/C17H27F2N3O2/c18-14(19)11-22-7-4-12(5-8-22)9-15(23)21-17-6-2-1-3-13(17)20-16(24)10-17/h12-14H,1-11H2,(H,20,24)(H,21,23)/t13-,17+/m0/s1 |
| InChIKey | KXYHNOYOZGUPIL-SUMWQHHRSA-N |
| XLogP | 1.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |