C15H18F3N5O — CID 136587994
[(3R,5S)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone (PubChem CID 136587994) has the molecular formula C15H18F3N5O and a molecular weight of 341.34 g/mol. Its IUPAC name is [(3R,5S)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone.
| Compound Name | [(3R,5S)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 136587994 |
| Molecular Formula | C15H18F3N5O |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [(3R,5S)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc3nncn3c2)C[C@H](C)N1CC(F)(F)F |
| InChI | InChI=1S/C15H18F3N5O/c1-10-5-21(6-11(2)23(10)8-15(16,17)18)14(24)12-3-4-13-20-19-9-22(13)7-12/h3-4,7,9-11H,5-6,8H2,1-2H3/t10-,11+ |
| InChIKey | FRGABODBSUSBLQ-PHIMTYICSA-N |
| XLogP | 1.83 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |