C14H23N5O — CID 136588099
(3aR,7aS)-N-(2-imidazol-1-ylethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide (PubChem CID 136588099) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is (3aR,7aS)-N-(2-imidazol-1-ylethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide.
| Compound Name | (3aR,7aS)-N-(2-imidazol-1-ylethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 136588099 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (3aR,7aS)-N-(2-imidazol-1-ylethyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide |
| SMILES | CN1CC[C@@H]2CCN(C(=O)NCCn3ccnc3)[C@@H]2C1 |
| InChI | InChI=1S/C14H23N5O/c1-17-6-2-12-3-7-19(13(12)10-17)14(20)16-5-9-18-8-4-15-11-18/h4,8,11-13H,2-3,5-7,9-10H2,1H3,(H,16,20)/t12-,13-/m1/s1 |
| InChIKey | CZQBSMDTJPUOKK-CHWSQXEVSA-N |
| XLogP | 0.62 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |