C17H28N4O2 — CID 136588112
(3aR,6aS)-N-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 136588112) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is (3aR,6aS)-N-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136588112 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (3aR,6aS)-N-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CN1C[C@@H]2CN(C(=O)NC3CCN(C(=O)C4CC4)CC3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H28N4O2/c1-19-8-13-10-21(11-14(13)9-19)17(23)18-15-4-6-20(7-5-15)16(22)12-2-3-12/h12-15H,2-11H2,1H3,(H,18,23)/t13-,14+ |
| InChIKey | OUZIZQUGGCVJSM-OKILXGFUSA-N |
| XLogP | 0.59 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |