C19H25NO3 — CID 136589388
(3aS,6aS)-2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid (PubChem CID 136589388) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (3aS,6aS)-2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid |
|---|---|
| PubChem CID | 136589388 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (3aS,6aS)-2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid |
| SMILES | COc1ccc2c(c1)CN(C1C[C@@H]3CCC[C@]3(C(=O)O)C1)CC2 |
| InChI | InChI=1S/C19H25NO3/c1-23-17-5-4-13-6-8-20(12-14(13)9-17)16-10-15-3-2-7-19(15,11-16)18(21)22/h4-5,9,15-16H,2-3,6-8,10-12H2,1H3,(H,21,22)/t15-,16?,19-/m0/s1 |
| InChIKey | CTKRWDZEKYMCES-QLYZIHHJSA-N |
| XLogP | 3.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |