About N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide
N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 136589461) has the molecular formula C15H24IN3OS
and a molecular weight of 421.35 g/mol. Its IUPAC name is N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide |
| PubChem CID | 136589461 |
| Molecular Formula | C15H24IN3OS |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NC1CC(OC)C1)N1CCCC1c1ccsc1.I |
| InChI | InChI=1S/C15H23N3OS.HI/c1-16-15(17-12-8-13(9-12)19-2)18-6-3-4-14(18)11-5-7-20-10-11;/h5,7,10,12-14H,3-4,6,8-9H2,1-2H3,(H,16,17);1H |
| InChIKey | YOYKMDNCUVGPER-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide?
The IUPAC name of N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide (CID 136589461) is N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide.
What is the SMILES notation for N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide?
The canonical SMILES for N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide is C/N=C(\NC1CC(OC)C1)N1CCCC1c1ccsc1.I.
What is the InChIKey of N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide?
The InChIKey is YOYKMDNCUVGPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS.HI/c1-16-15(17-12-8-13(9-12)19-2)18-6-3-4-14(18)11-5-7-20-10-11;/h5,7,10,12-14H,3-4,6,8-9H2,1-2H3,(H,16,17);1H.
What are the key properties of N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide?
N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide has a molecular weight of 421.35 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxycyclobutyl)-N'-methyl-2-thiophen-3-ylpyrrolidine-1-carboximidamide;hydroiodide is sourced from PubChem (CID 136589461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).