C14H24N4OS — CID 136589466
(2S,6R)-2,6-dimethyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide (PubChem CID 136589466) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide.
| Compound Name | (2S,6R)-2,6-dimethyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 136589466 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide |
| SMILES | Cc1csc(C(C)C/N=C(\N)N2C[C@@H](C)O[C@@H](C)C2)n1 |
| InChI | InChI=1S/C14H24N4OS/c1-9(13-17-10(2)8-20-13)5-16-14(15)18-6-11(3)19-12(4)7-18/h8-9,11-12H,5-7H2,1-4H3,(H2,15,16)/t9?,11-,12+ |
| InChIKey | ADDJZPQCVCTQAO-CLYYMRHHSA-N |
| XLogP | 1.98 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|