C16H17F3N6O4 — CID 136589760
3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,2-oxazole-4-carboxamide (PubChem CID 136589760) has the molecular formula C16H17F3N6O4 and a molecular weight of 414.34 g/mol. Its IUPAC name is 3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 136589760 |
| Molecular Formula | C16H17F3N6O4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1nonc1CNC(=O)c1c(-c2c(C)nn(C)c2OCC(F)(F)F)noc1C |
| InChI | InChI=1S/C16H17F3N6O4/c1-7-10(23-29-22-7)5-20-14(26)12-9(3)28-24-13(12)11-8(2)21-25(4)15(11)27-6-16(17,18)19/h5-6H2,1-4H3,(H,20,26) |
| InChIKey | AFWSBBFNVBYDHW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |